C6H12N4 — CID 141302340
N-methyl-1-propyl-1,2,4-triazol-3-amine (PubChem CID 141302340) has the molecular formula C6H12N4 and a molecular weight of 140.19 g/mol. Its IUPAC name is N-methyl-1-propyl-1,2,4-triazol-3-amine.
| Compound Name | N-methyl-1-propyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 141302340 |
| Molecular Formula | C6H12N4 |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.11 |
| IUPAC Name | N-methyl-1-propyl-1,2,4-triazol-3-amine |
| SMILES | CCCn1cnc(NC)n1 |
| InChI | InChI=1S/C6H12N4/c1-3-4-10-5-8-6(7-2)9-10/h5H,3-4H2,1-2H3,(H,7,9) |
| InChIKey | PSKZOFVOGLIRQU-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |