C20H24N4O6 — CID 14130235
[4-[3-(3,5-dioxopiperazin-1-yl)butan-2-yl]-2,6-dioxopiperazin-1-yl]methyl benzoate (PubChem CID 14130235) has the molecular formula C20H24N4O6 and a molecular weight of 416.43 g/mol. Its IUPAC name is [4-[3-(3,5-dioxopiperazin-1-yl)butan-2-yl]-2,6-dioxopiperazin-1-yl]methyl benzoate.
| Compound Name | [4-[3-(3,5-dioxopiperazin-1-yl)butan-2-yl]-2,6-dioxopiperazin-1-yl]methyl benzoate |
|---|---|
| PubChem CID | 14130235 |
| Molecular Formula | C20H24N4O6 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | [4-[3-(3,5-dioxopiperazin-1-yl)butan-2-yl]-2,6-dioxopiperazin-1-yl]methyl benzoate |
| SMILES | CC(C(C)N1CC(=O)N(COC(=O)c2ccccc2)C(=O)C1)N1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C20H24N4O6/c1-13(22-8-16(25)21-17(26)9-22)14(2)23-10-18(27)24(19(28)11-23)12-30-20(29)15-6-4-3-5-7-15/h3-7,13-14H,8-12H2,1-2H3,(H,21,25,26) |
| InChIKey | CWQVUHNOZROUBW-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|