About 3-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)pyridine
3-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)pyridine (PubChem CID 141302485) has the molecular formula C12H11NOS
and a molecular weight of 217.29 g/mol. Its IUPAC name is 3-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)pyridine.
Molecular Properties
| Compound Name | 3-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)pyridine |
| PubChem CID | 141302485 |
| Molecular Formula | C12H11NOS |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 3-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)pyridine |
| SMILES | c1cncc(-c2cc3c(s2)CCOC3)c1 |
| InChI | InChI=1S/C12H11NOS/c1-2-9(7-13-4-1)12-6-10-8-14-5-3-11(10)15-12/h1-2,4,6-7H,3,5,8H2 |
| InChIKey | LEGKQLZMXVFLKS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)pyridine?
The IUPAC name of 3-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)pyridine (CID 141302485) is 3-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)pyridine.
What is the SMILES notation for 3-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)pyridine?
The canonical SMILES for 3-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)pyridine is c1cncc(-c2cc3c(s2)CCOC3)c1.
What is the InChIKey of 3-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)pyridine?
The InChIKey is LEGKQLZMXVFLKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NOS/c1-2-9(7-13-4-1)12-6-10-8-14-5-3-11(10)15-12/h1-2,4,6-7H,3,5,8H2.
What are the key properties of 3-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)pyridine?
3-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)pyridine has a molecular weight of 217.29 g/mol, XLogP of 2.88, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)pyridine is sourced from PubChem (CID 141302485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).