About 2-chloro-7-ethyl-5-methyl-8-(1-methylpyrazol-4-yl)-6,7-dihydropteridine
2-chloro-7-ethyl-5-methyl-8-(1-methylpyrazol-4-yl)-6,7-dihydropteridine (PubChem CID 141302825) has the molecular formula C13H17ClN6
and a molecular weight of 292.77 g/mol. Its IUPAC name is 2-chloro-7-ethyl-5-methyl-8-(1-methylpyrazol-4-yl)-6,7-dihydropteridine.
Molecular Properties
| Compound Name | 2-chloro-7-ethyl-5-methyl-8-(1-methylpyrazol-4-yl)-6,7-dihydropteridine |
| PubChem CID | 141302825 |
| Molecular Formula | C13H17ClN6 |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 2-chloro-7-ethyl-5-methyl-8-(1-methylpyrazol-4-yl)-6,7-dihydropteridine |
| SMILES | CCC1CN(C)c2cnc(Cl)nc2N1c1cnn(C)c1 |
| InChI | InChI=1S/C13H17ClN6/c1-4-9-7-18(2)11-6-15-13(14)17-12(11)20(9)10-5-16-19(3)8-10/h5-6,8-9H,4,7H2,1-3H3 |
| InChIKey | DQXPSEIEAXBCIL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-chloro-7-ethyl-5-methyl-8-(1-methylpyrazol-4-yl)-6,7-dihydropteridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-7-ethyl-5-methyl-8-(1-methylpyrazol-4-yl)-6,7-dihydropteridine?
The IUPAC name of 2-chloro-7-ethyl-5-methyl-8-(1-methylpyrazol-4-yl)-6,7-dihydropteridine (CID 141302825) is 2-chloro-7-ethyl-5-methyl-8-(1-methylpyrazol-4-yl)-6,7-dihydropteridine.
What is the SMILES notation for 2-chloro-7-ethyl-5-methyl-8-(1-methylpyrazol-4-yl)-6,7-dihydropteridine?
The canonical SMILES for 2-chloro-7-ethyl-5-methyl-8-(1-methylpyrazol-4-yl)-6,7-dihydropteridine is CCC1CN(C)c2cnc(Cl)nc2N1c1cnn(C)c1.
What is the InChIKey of 2-chloro-7-ethyl-5-methyl-8-(1-methylpyrazol-4-yl)-6,7-dihydropteridine?
The InChIKey is DQXPSEIEAXBCIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClN6/c1-4-9-7-18(2)11-6-15-13(14)17-12(11)20(9)10-5-16-19(3)8-10/h5-6,8-9H,4,7H2,1-3H3.
What are the key properties of 2-chloro-7-ethyl-5-methyl-8-(1-methylpyrazol-4-yl)-6,7-dihydropteridine?
2-chloro-7-ethyl-5-methyl-8-(1-methylpyrazol-4-yl)-6,7-dihydropteridine has a molecular weight of 292.77 g/mol, XLogP of 2.23, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-7-ethyl-5-methyl-8-(1-methylpyrazol-4-yl)-6,7-dihydropteridine is sourced from PubChem (CID 141302825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).