C15H20N2O3 — CID 141303253
1-(5-methoxy-2,3-dihydroindol-1-yl)-2-morpholin-4-ylethanone (PubChem CID 141303253) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 1-(5-methoxy-2,3-dihydroindol-1-yl)-2-morpholin-4-ylethanone.
| Compound Name | 1-(5-methoxy-2,3-dihydroindol-1-yl)-2-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 141303253 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 1-(5-methoxy-2,3-dihydroindol-1-yl)-2-morpholin-4-ylethanone |
| SMILES | COc1ccc2c(c1)CCN2C(=O)CN1CCOCC1 |
| InChI | InChI=1S/C15H20N2O3/c1-19-13-2-3-14-12(10-13)4-5-17(14)15(18)11-16-6-8-20-9-7-16/h2-3,10H,4-9,11H2,1H3 |
| InChIKey | GEGMFLNSRCOSBG-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |