C9H14N4O3 — CID 141303739
3,5,5a,6,7,8,9a,10-octahydropyrano[3,2-g]pteridin-4-one;hydrate (PubChem CID 141303739) has the molecular formula C9H14N4O3 and a molecular weight of 226.24 g/mol. Its IUPAC name is 3,5,5a,6,7,8,9a,10-octahydropyrano[3,2-g]pteridin-4-one;hydrate.
| Compound Name | 3,5,5a,6,7,8,9a,10-octahydropyrano[3,2-g]pteridin-4-one;hydrate |
|---|---|
| PubChem CID | 141303739 |
| Molecular Formula | C9H14N4O3 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 3,5,5a,6,7,8,9a,10-octahydropyrano[3,2-g]pteridin-4-one;hydrate |
| SMILES | O.O=c1[nH]cnc2c1NC1CCCOC1N2 |
| InChI | InChI=1S/C9H12N4O2.H2O/c14-8-6-7(10-4-11-8)13-9-5(12-6)2-1-3-15-9;/h4-5,9,12H,1-3H2,(H2,10,11,13,14);1H2 |
| InChIKey | LCZBNLFZMQKDKR-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 110.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |