C9H12N4O2 — CID 141303740
3,5,5a,6,7,8,9a,10-octahydropyrano[3,2-g]pteridin-4-one (PubChem CID 141303740) has the molecular formula C9H12N4O2 and a molecular weight of 208.22 g/mol. Its IUPAC name is 3,5,5a,6,7,8,9a,10-octahydropyrano[3,2-g]pteridin-4-one.
| Compound Name | 3,5,5a,6,7,8,9a,10-octahydropyrano[3,2-g]pteridin-4-one |
|---|---|
| PubChem CID | 141303740 |
| Molecular Formula | C9H12N4O2 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 3,5,5a,6,7,8,9a,10-octahydropyrano[3,2-g]pteridin-4-one |
| SMILES | O=c1[nH]cnc2c1NC1CCCOC1N2 |
| InChI | InChI=1S/C9H12N4O2/c14-8-6-7(10-4-11-8)13-9-5(12-6)2-1-3-15-9/h4-5,9,12H,1-3H2,(H2,10,11,13,14) |
| InChIKey | BAIAKXCBJOIQFD-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |