About 9-iodo-6,7-dihydro-5H-pyrimido[5,4-d][1]benzazepin-2-amine
9-iodo-6,7-dihydro-5H-pyrimido[5,4-d][1]benzazepin-2-amine (PubChem CID 141303801) has the molecular formula C12H11IN4
and a molecular weight of 338.15 g/mol. Its IUPAC name is 9-iodo-6,7-dihydro-5H-pyrimido[5,4-d][1]benzazepin-2-amine.
Molecular Properties
| Compound Name | 9-iodo-6,7-dihydro-5H-pyrimido[5,4-d][1]benzazepin-2-amine |
| PubChem CID | 141303801 |
| Molecular Formula | C12H11IN4 |
| Molecular Weight | 338.15 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | 9-iodo-6,7-dihydro-5H-pyrimido[5,4-d][1]benzazepin-2-amine |
| SMILES | Nc1ncc2c(n1)-c1ccc(I)cc1NCC2 |
| InChI | InChI=1S/C12H11IN4/c13-8-1-2-9-10(5-8)15-4-3-7-6-16-12(14)17-11(7)9/h1-2,5-6,15H,3-4H2,(H2,14,16,17) |
| InChIKey | CCIRFVOLLGICKL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.15 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 9-iodo-6,7-dihydro-5H-pyrimido[5,4-d][1]benzazepin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-iodo-6,7-dihydro-5H-pyrimido[5,4-d][1]benzazepin-2-amine?
The IUPAC name of 9-iodo-6,7-dihydro-5H-pyrimido[5,4-d][1]benzazepin-2-amine (CID 141303801) is 9-iodo-6,7-dihydro-5H-pyrimido[5,4-d][1]benzazepin-2-amine.
What is the SMILES notation for 9-iodo-6,7-dihydro-5H-pyrimido[5,4-d][1]benzazepin-2-amine?
The canonical SMILES for 9-iodo-6,7-dihydro-5H-pyrimido[5,4-d][1]benzazepin-2-amine is Nc1ncc2c(n1)-c1ccc(I)cc1NCC2.
What is the InChIKey of 9-iodo-6,7-dihydro-5H-pyrimido[5,4-d][1]benzazepin-2-amine?
The InChIKey is CCIRFVOLLGICKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11IN4/c13-8-1-2-9-10(5-8)15-4-3-7-6-16-12(14)17-11(7)9/h1-2,5-6,15H,3-4H2,(H2,14,16,17).
What are the key properties of 9-iodo-6,7-dihydro-5H-pyrimido[5,4-d][1]benzazepin-2-amine?
9-iodo-6,7-dihydro-5H-pyrimido[5,4-d][1]benzazepin-2-amine has a molecular weight of 338.15 g/mol, XLogP of 2.30, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-iodo-6,7-dihydro-5H-pyrimido[5,4-d][1]benzazepin-2-amine is sourced from PubChem (CID 141303801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).