C10H11F9 — CID 141303830
6,6,7,7,8,8,9,9,9-nonafluoro-3-methylnon-2-ene (PubChem CID 141303830) has the molecular formula C10H11F9 and a molecular weight of 302.18 g/mol. Its IUPAC name is 6,6,7,7,8,8,9,9,9-nonafluoro-3-methylnon-2-ene.
| Compound Name | 6,6,7,7,8,8,9,9,9-nonafluoro-3-methylnon-2-ene |
|---|---|
| PubChem CID | 141303830 |
| Molecular Formula | C10H11F9 |
| Molecular Weight | 302.18 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 6,6,7,7,8,8,9,9,9-nonafluoro-3-methylnon-2-ene |
| SMILES | CC=C(C)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H11F9/c1-3-6(2)4-5-7(11,12)8(13,14)9(15,16)10(17,18)19/h3H,4-5H2,1-2H3 |
| InChIKey | ISNIJAGNALHZOE-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.18 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|