About 4H-indole-5-sulfonamide
4H-indole-5-sulfonamide (PubChem CID 141303895) has the molecular formula C8H8N2O2S
and a molecular weight of 196.23 g/mol. Its IUPAC name is 4H-indole-5-sulfonamide.
Molecular Properties
| Compound Name | 4H-indole-5-sulfonamide |
| PubChem CID | 141303895 |
| Molecular Formula | C8H8N2O2S |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.03 |
| IUPAC Name | 4H-indole-5-sulfonamide |
| SMILES | NS(=O)(=O)C1=CC=C2N=CC=C2C1 |
| InChI | InChI=1S/C8H8N2O2S/c9-13(11,12)7-1-2-8-6(5-7)3-4-10-8/h1-4H,5H2,(H2,9,11,12) |
| InChIKey | WPVJAZWYXDZDGV-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4H-indole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-indole-5-sulfonamide?
The IUPAC name of 4H-indole-5-sulfonamide (CID 141303895) is 4H-indole-5-sulfonamide.
What is the SMILES notation for 4H-indole-5-sulfonamide?
The canonical SMILES for 4H-indole-5-sulfonamide is NS(=O)(=O)C1=CC=C2N=CC=C2C1.
What is the InChIKey of 4H-indole-5-sulfonamide?
The InChIKey is WPVJAZWYXDZDGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O2S/c9-13(11,12)7-1-2-8-6(5-7)3-4-10-8/h1-4H,5H2,(H2,9,11,12).
What are the key properties of 4H-indole-5-sulfonamide?
4H-indole-5-sulfonamide has a molecular weight of 196.23 g/mol, XLogP of 0.46, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-indole-5-sulfonamide is sourced from PubChem (CID 141303895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).