About (2S,3R)-2-ethyl-4,4-difluoropyrrolidin-3-ol
(2S,3R)-2-ethyl-4,4-difluoropyrrolidin-3-ol (PubChem CID 141303945) has the molecular formula C6H11F2NO
and a molecular weight of 151.16 g/mol. Its IUPAC name is (2S,3R)-2-ethyl-4,4-difluoropyrrolidin-3-ol.
Molecular Properties
| Compound Name | (2S,3R)-2-ethyl-4,4-difluoropyrrolidin-3-ol |
| PubChem CID | 141303945 |
| Molecular Formula | C6H11F2NO |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | (2S,3R)-2-ethyl-4,4-difluoropyrrolidin-3-ol |
| SMILES | CC[C@@H]1NCC(F)(F)[C@@H]1O |
| InChI | InChI=1S/C6H11F2NO/c1-2-4-5(10)6(7,8)3-9-4/h4-5,9-10H,2-3H2,1H3/t4-,5+/m0/s1 |
| InChIKey | FJRZPAVBQMOXOH-CRCLSJGQSA-N |
| XLogP | 0.36 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,3R)-2-ethyl-4,4-difluoropyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3R)-2-ethyl-4,4-difluoropyrrolidin-3-ol?
The IUPAC name of (2S,3R)-2-ethyl-4,4-difluoropyrrolidin-3-ol (CID 141303945) is (2S,3R)-2-ethyl-4,4-difluoropyrrolidin-3-ol.
What is the SMILES notation for (2S,3R)-2-ethyl-4,4-difluoropyrrolidin-3-ol?
The canonical SMILES for (2S,3R)-2-ethyl-4,4-difluoropyrrolidin-3-ol is CC[C@@H]1NCC(F)(F)[C@@H]1O.
What is the InChIKey of (2S,3R)-2-ethyl-4,4-difluoropyrrolidin-3-ol?
The InChIKey is FJRZPAVBQMOXOH-CRCLSJGQSA-N. The full InChI is InChI=1S/C6H11F2NO/c1-2-4-5(10)6(7,8)3-9-4/h4-5,9-10H,2-3H2,1H3/t4-,5+/m0/s1.
What are the key properties of (2S,3R)-2-ethyl-4,4-difluoropyrrolidin-3-ol?
(2S,3R)-2-ethyl-4,4-difluoropyrrolidin-3-ol has a molecular weight of 151.16 g/mol, XLogP of 0.36, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R)-2-ethyl-4,4-difluoropyrrolidin-3-ol is sourced from PubChem (CID 141303945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).