C11H15ClN4 — CID 141304217
5-(5-chloro-4-methylpyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 141304217) has the molecular formula C11H15ClN4 and a molecular weight of 238.72 g/mol. Its IUPAC name is 5-(5-chloro-4-methylpyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | 5-(5-chloro-4-methylpyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 141304217 |
| Molecular Formula | C11H15ClN4 |
| Molecular Weight | 238.72 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 5-(5-chloro-4-methylpyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | Cc1nc(N2CC3CNCC3C2)ncc1Cl |
| InChI | InChI=1S/C11H15ClN4/c1-7-10(12)4-14-11(15-7)16-5-8-2-13-3-9(8)6-16/h4,8-9,13H,2-3,5-6H2,1H3 |
| InChIKey | METAKULTCXOODQ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.72 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |