C23H19N3 — CID 141304902
2-methyl-7,8-diphenyl-4,5-dihydropyrazolo[3,4-f]quinoline (PubChem CID 141304902) has the molecular formula C23H19N3 and a molecular weight of 337.43 g/mol. Its IUPAC name is 2-methyl-7,8-diphenyl-4,5-dihydropyrazolo[3,4-f]quinoline.
| Compound Name | 2-methyl-7,8-diphenyl-4,5-dihydropyrazolo[3,4-f]quinoline |
|---|---|
| PubChem CID | 141304902 |
| Molecular Formula | C23H19N3 |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 2-methyl-7,8-diphenyl-4,5-dihydropyrazolo[3,4-f]quinoline |
| SMILES | Cn1cc2c(n1)-c1cc(-c3ccccc3)c(-c3ccccc3)nc1CC2 |
| InChI | InChI=1S/C23H19N3/c1-26-15-18-12-13-21-20(23(18)25-26)14-19(16-8-4-2-5-9-16)22(24-21)17-10-6-3-7-11-17/h2-11,14-15H,12-13H2,1H3 |
| InChIKey | XCNMSCCJMOBYPE-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |