About 2-[5-(2-methyl-1,3-dioxol-2-yl)furan-2-yl]acetonitrile
2-[5-(2-methyl-1,3-dioxol-2-yl)furan-2-yl]acetonitrile (PubChem CID 141305773) has the molecular formula C10H9NO3
and a molecular weight of 191.19 g/mol. Its IUPAC name is 2-[5-(2-methyl-1,3-dioxol-2-yl)furan-2-yl]acetonitrile.
Molecular Properties
| Compound Name | 2-[5-(2-methyl-1,3-dioxol-2-yl)furan-2-yl]acetonitrile |
| PubChem CID | 141305773 |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | 2-[5-(2-methyl-1,3-dioxol-2-yl)furan-2-yl]acetonitrile |
| SMILES | CC1(c2ccc(CC#N)o2)OC=CO1 |
| InChI | InChI=1S/C10H9NO3/c1-10(12-6-7-13-10)9-3-2-8(14-9)4-5-11/h2-3,6-7H,4H2,1H3 |
| InChIKey | UKRCCIYEEDFYIH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 55.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[5-(2-methyl-1,3-dioxol-2-yl)furan-2-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(2-methyl-1,3-dioxol-2-yl)furan-2-yl]acetonitrile?
The IUPAC name of 2-[5-(2-methyl-1,3-dioxol-2-yl)furan-2-yl]acetonitrile (CID 141305773) is 2-[5-(2-methyl-1,3-dioxol-2-yl)furan-2-yl]acetonitrile.
What is the SMILES notation for 2-[5-(2-methyl-1,3-dioxol-2-yl)furan-2-yl]acetonitrile?
The canonical SMILES for 2-[5-(2-methyl-1,3-dioxol-2-yl)furan-2-yl]acetonitrile is CC1(c2ccc(CC#N)o2)OC=CO1.
What is the InChIKey of 2-[5-(2-methyl-1,3-dioxol-2-yl)furan-2-yl]acetonitrile?
The InChIKey is UKRCCIYEEDFYIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO3/c1-10(12-6-7-13-10)9-3-2-8(14-9)4-5-11/h2-3,6-7H,4H2,1H3.
What are the key properties of 2-[5-(2-methyl-1,3-dioxol-2-yl)furan-2-yl]acetonitrile?
2-[5-(2-methyl-1,3-dioxol-2-yl)furan-2-yl]acetonitrile has a molecular weight of 191.19 g/mol, XLogP of 2.04, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(2-methyl-1,3-dioxol-2-yl)furan-2-yl]acetonitrile is sourced from PubChem (CID 141305773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).