C22H25ClN4 — CID 141305852
2-[2-chloro-5-[(3R)-3-pyrrolidin-1-ylpiperidin-1-yl]phenyl]-1H-benzimidazole (PubChem CID 141305852) has the molecular formula C22H25ClN4 and a molecular weight of 380.92 g/mol. Its IUPAC name is 2-[2-chloro-5-[(3R)-3-pyrrolidin-1-ylpiperidin-1-yl]phenyl]-1H-benzimidazole.
| Compound Name | 2-[2-chloro-5-[(3R)-3-pyrrolidin-1-ylpiperidin-1-yl]phenyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 141305852 |
| Molecular Formula | C22H25ClN4 |
| Molecular Weight | 380.92 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 2-[2-chloro-5-[(3R)-3-pyrrolidin-1-ylpiperidin-1-yl]phenyl]-1H-benzimidazole |
| SMILES | Clc1ccc(N2CCC[C@@H](N3CCCC3)C2)cc1-c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C22H25ClN4/c23-19-10-9-16(27-13-5-6-17(15-27)26-11-3-4-12-26)14-18(19)22-24-20-7-1-2-8-21(20)25-22/h1-2,7-10,14,17H,3-6,11-13,15H2,(H,24,25)/t17-/m1/s1 |
| InChIKey | GKAOBEVTGBCVTI-QGZVFWFLSA-N |
| XLogP | 4.95 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.92 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |