C16H23NO6S — CID 141306174
5-[4-(2-piperidin-4-yloxyethoxy)phenyl]-1,3,2-dioxathiane 2,2-dioxide (PubChem CID 141306174) has the molecular formula C16H23NO6S and a molecular weight of 357.43 g/mol. Its IUPAC name is 5-[4-(2-piperidin-4-yloxyethoxy)phenyl]-1,3,2-dioxathiane 2,2-dioxide.
| Compound Name | 5-[4-(2-piperidin-4-yloxyethoxy)phenyl]-1,3,2-dioxathiane 2,2-dioxide |
|---|---|
| PubChem CID | 141306174 |
| Molecular Formula | C16H23NO6S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 5-[4-(2-piperidin-4-yloxyethoxy)phenyl]-1,3,2-dioxathiane 2,2-dioxide |
| SMILES | O=S1(=O)OCC(c2ccc(OCCOC3CCNCC3)cc2)CO1 |
| InChI | InChI=1S/C16H23NO6S/c18-24(19)22-11-14(12-23-24)13-1-3-15(4-2-13)20-9-10-21-16-5-7-17-8-6-16/h1-4,14,16-17H,5-12H2 |
| InChIKey | VZBLCKXLGOBPLJ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|