C11H16F5N — CID 141306201
(2S)-2-[(Z)-6,6,7,7,7-pentafluorohept-1-enyl]pyrrolidine (PubChem CID 141306201) has the molecular formula C11H16F5N and a molecular weight of 257.25 g/mol. Its IUPAC name is (2S)-2-[(Z)-6,6,7,7,7-pentafluorohept-1-enyl]pyrrolidine.
| Compound Name | (2S)-2-[(Z)-6,6,7,7,7-pentafluorohept-1-enyl]pyrrolidine |
|---|---|
| PubChem CID | 141306201 |
| Molecular Formula | C11H16F5N |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | (2S)-2-[(Z)-6,6,7,7,7-pentafluorohept-1-enyl]pyrrolidine |
| SMILES | FC(F)(F)C(F)(F)CCC/C=C\[C@@H]1CCCN1 |
| InChI | InChI=1S/C11H16F5N/c12-10(13,11(14,15)16)7-3-1-2-5-9-6-4-8-17-9/h2,5,9,17H,1,3-4,6-8H2/b5-2-/t9-/m1/s1 |
| InChIKey | XJHZBLOKIHCFPJ-JHYPKJRRSA-N |
| XLogP | 3.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|