C12H9ClFNO3 — CID 141306208
(2Z,5E)-2-amino-6-(4-chloro-2-fluorophenyl)-4-oxohexa-2,5-dienoic acid (PubChem CID 141306208) has the molecular formula C12H9ClFNO3 and a molecular weight of 269.66 g/mol. Its IUPAC name is (2Z,5E)-2-amino-6-(4-chloro-2-fluorophenyl)-4-oxohexa-2,5-dienoic acid.
| Compound Name | (2Z,5E)-2-amino-6-(4-chloro-2-fluorophenyl)-4-oxohexa-2,5-dienoic acid |
|---|---|
| PubChem CID | 141306208 |
| Molecular Formula | C12H9ClFNO3 |
| Molecular Weight | 269.66 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | (2Z,5E)-2-amino-6-(4-chloro-2-fluorophenyl)-4-oxohexa-2,5-dienoic acid |
| SMILES | N/C(=C\C(=O)/C=C/c1ccc(Cl)cc1F)C(=O)O |
| InChI | InChI=1S/C12H9ClFNO3/c13-8-3-1-7(10(14)5-8)2-4-9(16)6-11(15)12(17)18/h1-6H,15H2,(H,17,18)/b4-2+,11-6- |
| InChIKey | CUHXZMQVYAUARX-YPKFHECUSA-N |
| XLogP | 1.99 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.66 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|