C19H27ClO11 — CID 141306480
(2R,3R,4R,5S,6R)-2-[(4-chlorophenyl)methyl]-6-(hydroxymethyl)-5-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-2,3,4-triol (PubChem CID 141306480) has the molecular formula C19H27ClO11 and a molecular weight of 466.87 g/mol. Its IUPAC name is (2R,3R,4R,5S,6R)-2-[(4-chlorophenyl)methyl]-6-(hydroxymethyl)-5-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-2,3,4-triol.
| Compound Name | (2R,3R,4R,5S,6R)-2-[(4-chlorophenyl)methyl]-6-(hydroxymethyl)-5-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-2,3,4-triol |
|---|---|
| PubChem CID | 141306480 |
| Molecular Formula | C19H27ClO11 |
| Molecular Weight | 466.87 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | (2R,3R,4R,5S,6R)-2-[(4-chlorophenyl)methyl]-6-(hydroxymethyl)-5-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-2,3,4-triol |
| SMILES | OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@@](O)(Cc3ccc(Cl)cc3)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H27ClO11/c20-9-3-1-8(2-4-9)5-19(28)17(27)15(26)16(11(7-22)31-19)30-18-14(25)13(24)12(23)10(6-21)29-18/h1-4,10-18,21-28H,5-7H2/t10-,11-,12+,13+,14-,15+,16-,17-,18+,19-/m1/s1 |
| InChIKey | MIZSXXFBFSFWHA-MLYNWVHISA-N |
| XLogP | -3.13 |
| TPSA | 189.53 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.87 |
| LogP ≤ 5 | -3.13 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |