C10H8BrF3O — CID 141307283
5-bromo-7-(trifluoromethyl)-2,3,4,5-tetrahydroinden-1-one (PubChem CID 141307283) has the molecular formula C10H8BrF3O and a molecular weight of 281.07 g/mol. Its IUPAC name is 5-bromo-7-(trifluoromethyl)-2,3,4,5-tetrahydroinden-1-one.
| Compound Name | 5-bromo-7-(trifluoromethyl)-2,3,4,5-tetrahydroinden-1-one |
|---|---|
| PubChem CID | 141307283 |
| Molecular Formula | C10H8BrF3O |
| Molecular Weight | 281.07 g/mol |
| Exact Mass | 279.97 |
| IUPAC Name | 5-bromo-7-(trifluoromethyl)-2,3,4,5-tetrahydroinden-1-one |
| SMILES | O=C1CCC2=C1C(C(F)(F)F)=CC(Br)C2 |
| InChI | InChI=1S/C10H8BrF3O/c11-6-3-5-1-2-8(15)9(5)7(4-6)10(12,13)14/h4,6H,1-3H2 |
| InChIKey | GTFVBTPFWKFMRQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.07 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|