About 1-ethyl-4,5,6,7-tetrahydro-2-benzothiophene
1-ethyl-4,5,6,7-tetrahydro-2-benzothiophene (PubChem CID 141307299) has the molecular formula C10H14S
and a molecular weight of 166.29 g/mol. Its IUPAC name is 1-ethyl-4,5,6,7-tetrahydro-2-benzothiophene.
Molecular Properties
| Compound Name | 1-ethyl-4,5,6,7-tetrahydro-2-benzothiophene |
| PubChem CID | 141307299 |
| Molecular Formula | C10H14S |
| Molecular Weight | 166.29 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | 1-ethyl-4,5,6,7-tetrahydro-2-benzothiophene |
| SMILES | CCc1scc2c1CCCC2 |
| InChI | InChI=1S/C10H14S/c1-2-10-9-6-4-3-5-8(9)7-11-10/h7H,2-6H2,1H3 |
| InChIKey | FOYONGIZTBACPC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-ethyl-4,5,6,7-tetrahydro-2-benzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4,5,6,7-tetrahydro-2-benzothiophene?
The IUPAC name of 1-ethyl-4,5,6,7-tetrahydro-2-benzothiophene (CID 141307299) is 1-ethyl-4,5,6,7-tetrahydro-2-benzothiophene.
What is the SMILES notation for 1-ethyl-4,5,6,7-tetrahydro-2-benzothiophene?
The canonical SMILES for 1-ethyl-4,5,6,7-tetrahydro-2-benzothiophene is CCc1scc2c1CCCC2.
What is the InChIKey of 1-ethyl-4,5,6,7-tetrahydro-2-benzothiophene?
The InChIKey is FOYONGIZTBACPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14S/c1-2-10-9-6-4-3-5-8(9)7-11-10/h7H,2-6H2,1H3.
What are the key properties of 1-ethyl-4,5,6,7-tetrahydro-2-benzothiophene?
1-ethyl-4,5,6,7-tetrahydro-2-benzothiophene has a molecular weight of 166.29 g/mol, XLogP of 3.19, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4,5,6,7-tetrahydro-2-benzothiophene is sourced from PubChem (CID 141307299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).