C10H11FN2 — CID 141307712
5-(4-fluorophenyl)-2-methyl-3,4-dihydropyrazole (PubChem CID 141307712) has the molecular formula C10H11FN2 and a molecular weight of 178.21 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-2-methyl-3,4-dihydropyrazole.
| Compound Name | 5-(4-fluorophenyl)-2-methyl-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 141307712 |
| Molecular Formula | C10H11FN2 |
| Molecular Weight | 178.21 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 5-(4-fluorophenyl)-2-methyl-3,4-dihydropyrazole |
| SMILES | CN1CCC(c2ccc(F)cc2)=N1 |
| InChI | InChI=1S/C10H11FN2/c1-13-7-6-10(12-13)8-2-4-9(11)5-3-8/h2-5H,6-7H2,1H3 |
| InChIKey | FQSRDKRRNHMMIW-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.21 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |