About 2-(4-methoxy-3,5-dimethylphenyl)-5-pyridin-3-yloxy-7H-pyrrolo[2,3-d]pyrimidine
2-(4-methoxy-3,5-dimethylphenyl)-5-pyridin-3-yloxy-7H-pyrrolo[2,3-d]pyrimidine (PubChem CID 141307903) has the molecular formula C20H18N4O2
and a molecular weight of 346.39 g/mol. Its IUPAC name is 2-(4-methoxy-3,5-dimethylphenyl)-5-pyridin-3-yloxy-7H-pyrrolo[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 2-(4-methoxy-3,5-dimethylphenyl)-5-pyridin-3-yloxy-7H-pyrrolo[2,3-d]pyrimidine |
| PubChem CID | 141307903 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 2-(4-methoxy-3,5-dimethylphenyl)-5-pyridin-3-yloxy-7H-pyrrolo[2,3-d]pyrimidine |
| SMILES | COc1c(C)cc(-c2ncc3c(Oc4cccnc4)c[nH]c3n2)cc1C |
| InChI | InChI=1S/C20H18N4O2/c1-12-7-14(8-13(2)18(12)25-3)19-22-10-16-17(11-23-20(16)24-19)26-15-5-4-6-21-9-15/h4-11H,1-3H3,(H,22,23,24) |
| InChIKey | AECJYVJVEMBNCM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-methoxy-3,5-dimethylphenyl)-5-pyridin-3-yloxy-7H-pyrrolo[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methoxy-3,5-dimethylphenyl)-5-pyridin-3-yloxy-7H-pyrrolo[2,3-d]pyrimidine?
The IUPAC name of 2-(4-methoxy-3,5-dimethylphenyl)-5-pyridin-3-yloxy-7H-pyrrolo[2,3-d]pyrimidine (CID 141307903) is 2-(4-methoxy-3,5-dimethylphenyl)-5-pyridin-3-yloxy-7H-pyrrolo[2,3-d]pyrimidine.
What is the SMILES notation for 2-(4-methoxy-3,5-dimethylphenyl)-5-pyridin-3-yloxy-7H-pyrrolo[2,3-d]pyrimidine?
The canonical SMILES for 2-(4-methoxy-3,5-dimethylphenyl)-5-pyridin-3-yloxy-7H-pyrrolo[2,3-d]pyrimidine is COc1c(C)cc(-c2ncc3c(Oc4cccnc4)c[nH]c3n2)cc1C.
What is the InChIKey of 2-(4-methoxy-3,5-dimethylphenyl)-5-pyridin-3-yloxy-7H-pyrrolo[2,3-d]pyrimidine?
The InChIKey is AECJYVJVEMBNCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N4O2/c1-12-7-14(8-13(2)18(12)25-3)19-22-10-16-17(11-23-20(16)24-19)26-15-5-4-6-21-9-15/h4-11H,1-3H3,(H,22,23,24).
What are the key properties of 2-(4-methoxy-3,5-dimethylphenyl)-5-pyridin-3-yloxy-7H-pyrrolo[2,3-d]pyrimidine?
2-(4-methoxy-3,5-dimethylphenyl)-5-pyridin-3-yloxy-7H-pyrrolo[2,3-d]pyrimidine has a molecular weight of 346.39 g/mol, XLogP of 4.44, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methoxy-3,5-dimethylphenyl)-5-pyridin-3-yloxy-7H-pyrrolo[2,3-d]pyrimidine is sourced from PubChem (CID 141307903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).