About fluoro-bis(2,3,4-trimethylphenyl)borane
fluoro-bis(2,3,4-trimethylphenyl)borane (PubChem CID 141308101) has the molecular formula C18H22BF
and a molecular weight of 268.18 g/mol. Its IUPAC name is fluoro-bis(2,3,4-trimethylphenyl)borane.
Molecular Properties
| Compound Name | fluoro-bis(2,3,4-trimethylphenyl)borane |
| PubChem CID | 141308101 |
| Molecular Formula | C18H22BF |
| Molecular Weight | 268.18 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | fluoro-bis(2,3,4-trimethylphenyl)borane |
| SMILES | Cc1ccc(B(F)c2ccc(C)c(C)c2C)c(C)c1C |
| InChI | InChI=1S/C18H22BF/c1-11-7-9-17(15(5)13(11)3)19(20)18-10-8-12(2)14(4)16(18)6/h7-10H,1-6H3 |
| InChIKey | DWGRAWXTWKMPOT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.18 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze fluoro-bis(2,3,4-trimethylphenyl)borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro-bis(2,3,4-trimethylphenyl)borane?
The IUPAC name of fluoro-bis(2,3,4-trimethylphenyl)borane (CID 141308101) is fluoro-bis(2,3,4-trimethylphenyl)borane.
What is the SMILES notation for fluoro-bis(2,3,4-trimethylphenyl)borane?
The canonical SMILES for fluoro-bis(2,3,4-trimethylphenyl)borane is Cc1ccc(B(F)c2ccc(C)c(C)c2C)c(C)c1C.
What is the InChIKey of fluoro-bis(2,3,4-trimethylphenyl)borane?
The InChIKey is DWGRAWXTWKMPOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22BF/c1-11-7-9-17(15(5)13(11)3)19(20)18-10-8-12(2)14(4)16(18)6/h7-10H,1-6H3.
What are the key properties of fluoro-bis(2,3,4-trimethylphenyl)borane?
fluoro-bis(2,3,4-trimethylphenyl)borane has a molecular weight of 268.18 g/mol, XLogP of 3.61, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro-bis(2,3,4-trimethylphenyl)borane is sourced from PubChem (CID 141308101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).