C25H20F6O4 — CID 141308176
[2-(1,1-difluoroethoxy)phenyl] 4-[1-(4-ethoxy-2,3,5,6-tetrafluorophenyl)ethyl]benzoate (PubChem CID 141308176) has the molecular formula C25H20F6O4 and a molecular weight of 498.42 g/mol. Its IUPAC name is [2-(1,1-difluoroethoxy)phenyl] 4-[1-(4-ethoxy-2,3,5,6-tetrafluorophenyl)ethyl]benzoate.
| Compound Name | [2-(1,1-difluoroethoxy)phenyl] 4-[1-(4-ethoxy-2,3,5,6-tetrafluorophenyl)ethyl]benzoate |
|---|---|
| PubChem CID | 141308176 |
| Molecular Formula | C25H20F6O4 |
| Molecular Weight | 498.42 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | [2-(1,1-difluoroethoxy)phenyl] 4-[1-(4-ethoxy-2,3,5,6-tetrafluorophenyl)ethyl]benzoate |
| SMILES | CCOc1c(F)c(F)c(C(C)c2ccc(C(=O)Oc3ccccc3OC(C)(F)F)cc2)c(F)c1F |
| InChI | InChI=1S/C25H20F6O4/c1-4-33-23-21(28)19(26)18(20(27)22(23)29)13(2)14-9-11-15(12-10-14)24(32)34-16-7-5-6-8-17(16)35-25(3,30)31/h5-13H,4H2,1-3H3 |
| InChIKey | AQRWXPLPDXCNHM-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.42 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|