C19H16F2N2O3 — CID 141308336
6-[(3,5-difluorophenyl)methyl]-1-(phenylmethoxymethyl)pyrimidine-2,4-dione (PubChem CID 141308336) has the molecular formula C19H16F2N2O3 and a molecular weight of 358.34 g/mol. Its IUPAC name is 6-[(3,5-difluorophenyl)methyl]-1-(phenylmethoxymethyl)pyrimidine-2,4-dione.
| Compound Name | 6-[(3,5-difluorophenyl)methyl]-1-(phenylmethoxymethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 141308336 |
| Molecular Formula | C19H16F2N2O3 |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 6-[(3,5-difluorophenyl)methyl]-1-(phenylmethoxymethyl)pyrimidine-2,4-dione |
| SMILES | O=c1cc(Cc2cc(F)cc(F)c2)n(COCc2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C19H16F2N2O3/c20-15-6-14(7-16(21)9-15)8-17-10-18(24)22-19(25)23(17)12-26-11-13-4-2-1-3-5-13/h1-7,9-10H,8,11-12H2,(H,22,24,25) |
| InChIKey | ZZPKHEDBIXTWOU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |