About 8-[4-(2,2,2-trifluoroethoxy)phenyl]-2-oxa-8-azadispiro[2.2.46.23]dodecane
8-[4-(2,2,2-trifluoroethoxy)phenyl]-2-oxa-8-azadispiro[2.2.46.23]dodecane (PubChem CID 141308716) has the molecular formula C18H22F3NO2
and a molecular weight of 341.37 g/mol. Its IUPAC name is 8-[4-(2,2,2-trifluoroethoxy)phenyl]-2-oxa-8-azadispiro[2.2.46.23]dodecane.
Molecular Properties
| Compound Name | 8-[4-(2,2,2-trifluoroethoxy)phenyl]-2-oxa-8-azadispiro[2.2.46.23]dodecane |
| PubChem CID | 141308716 |
| Molecular Formula | C18H22F3NO2 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 8-[4-(2,2,2-trifluoroethoxy)phenyl]-2-oxa-8-azadispiro[2.2.46.23]dodecane |
| SMILES | FC(F)(F)COc1ccc(N2CCC3(CCC4(CC3)CO4)C2)cc1 |
| InChI | InChI=1S/C18H22F3NO2/c19-18(20,21)13-23-15-3-1-14(2-4-15)22-10-9-16(11-22)5-7-17(8-6-16)12-24-17/h1-4H,5-13H2 |
| InChIKey | RRFYATQJIZIEQF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 25.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 8-[4-(2,2,2-trifluoroethoxy)phenyl]-2-oxa-8-azadispiro[2.2.46.23]dodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[4-(2,2,2-trifluoroethoxy)phenyl]-2-oxa-8-azadispiro[2.2.46.23]dodecane?
The IUPAC name of 8-[4-(2,2,2-trifluoroethoxy)phenyl]-2-oxa-8-azadispiro[2.2.46.23]dodecane (CID 141308716) is 8-[4-(2,2,2-trifluoroethoxy)phenyl]-2-oxa-8-azadispiro[2.2.46.23]dodecane.
What is the SMILES notation for 8-[4-(2,2,2-trifluoroethoxy)phenyl]-2-oxa-8-azadispiro[2.2.46.23]dodecane?
The canonical SMILES for 8-[4-(2,2,2-trifluoroethoxy)phenyl]-2-oxa-8-azadispiro[2.2.46.23]dodecane is FC(F)(F)COc1ccc(N2CCC3(CCC4(CC3)CO4)C2)cc1.
What is the InChIKey of 8-[4-(2,2,2-trifluoroethoxy)phenyl]-2-oxa-8-azadispiro[2.2.46.23]dodecane?
The InChIKey is RRFYATQJIZIEQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22F3NO2/c19-18(20,21)13-23-15-3-1-14(2-4-15)22-10-9-16(11-22)5-7-17(8-6-16)12-24-17/h1-4H,5-13H2.
What are the key properties of 8-[4-(2,2,2-trifluoroethoxy)phenyl]-2-oxa-8-azadispiro[2.2.46.23]dodecane?
8-[4-(2,2,2-trifluoroethoxy)phenyl]-2-oxa-8-azadispiro[2.2.46.23]dodecane has a molecular weight of 341.37 g/mol, XLogP of 4.17, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[4-(2,2,2-trifluoroethoxy)phenyl]-2-oxa-8-azadispiro[2.2.46.23]dodecane is sourced from PubChem (CID 141308716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).