C40H70O18 — CID 14130894
6,7,25,26,32-pentahydroxy-5,24,31-trimethyl-20-pentyl-33-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-2,4,9,21,23,28,30-heptaoxatetracyclo[27.3.1.03,8.022,27]tritriacontan-10-one (PubChem CID 14130894) has the molecular formula C40H70O18 and a molecular weight of 838.98 g/mol. Its IUPAC name is 6,7,25,26,32-pentahydroxy-5,24,31-trimethyl-20-pentyl-33-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-2,4,9,21,23,28,30-heptaoxatetracyclo[27.3.1.03,8.022,27]tritriacontan-10-one.
| Compound Name | 6,7,25,26,32-pentahydroxy-5,24,31-trimethyl-20-pentyl-33-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-2,4,9,21,23,28,30-heptaoxatetracyclo[27.3.1.03,8.022,27]tritriacontan-10-one |
|---|---|
| PubChem CID | 14130894 |
| Molecular Formula | C40H70O18 |
| Molecular Weight | 838.98 g/mol |
| Exact Mass | 838.46 |
| IUPAC Name | 6,7,25,26,32-pentahydroxy-5,24,31-trimethyl-20-pentyl-33-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-2,4,9,21,23,28,30-heptaoxatetracyclo[27.3.1.03,8.022,27]tritriacontan-10-one |
| SMILES | CCCCCC1CCCCCCCCCC(=O)OC2C(OC(C)C(O)C2O)OC2C(O)C(C)OC(OC3C(O1)OC(C)C(O)C3O)C2OC1OC(C)C(O)C(O)C1O |
| InChI | InChI=1S/C40H70O18/c1-6-7-13-16-23-17-14-11-9-8-10-12-15-18-24(41)55-34-30(47)26(43)21(4)52-39(34)56-33-28(45)22(5)53-40(57-35-31(48)27(44)20(3)51-38(35)54-23)36(33)58-37-32(49)29(46)25(42)19(2)50-37/h19-23,25-40,42-49H,6-18H2,1-5H3 |
| InChIKey | PABJBITVWCLTSO-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 261.98 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.98 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|