About 2-[3-(4-tert-butylphenyl)phenyl]-6-chloro-3,3-dimethyl-2,4-dihydro-1H-quinoline
2-[3-(4-tert-butylphenyl)phenyl]-6-chloro-3,3-dimethyl-2,4-dihydro-1H-quinoline (PubChem CID 141309286) has the molecular formula C27H30ClN
and a molecular weight of 404.00 g/mol. Its IUPAC name is 2-[3-(4-tert-butylphenyl)phenyl]-6-chloro-3,3-dimethyl-2,4-dihydro-1H-quinoline.
Molecular Properties
| Compound Name | 2-[3-(4-tert-butylphenyl)phenyl]-6-chloro-3,3-dimethyl-2,4-dihydro-1H-quinoline |
| PubChem CID | 141309286 |
| Molecular Formula | C27H30ClN |
| Molecular Weight | 404.00 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | 2-[3-(4-tert-butylphenyl)phenyl]-6-chloro-3,3-dimethyl-2,4-dihydro-1H-quinoline |
| SMILES | CC(C)(C)c1ccc(-c2cccc(C3Nc4ccc(Cl)cc4CC3(C)C)c2)cc1 |
| InChI | InChI=1S/C27H30ClN/c1-26(2,3)22-11-9-18(10-12-22)19-7-6-8-20(15-19)25-27(4,5)17-21-16-23(28)13-14-24(21)29-25/h6-16,25,29H,17H2,1-5H3 |
| InChIKey | OVFQIRGVHSECQR-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.00 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[3-(4-tert-butylphenyl)phenyl]-6-chloro-3,3-dimethyl-2,4-dihydro-1H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(4-tert-butylphenyl)phenyl]-6-chloro-3,3-dimethyl-2,4-dihydro-1H-quinoline?
The IUPAC name of 2-[3-(4-tert-butylphenyl)phenyl]-6-chloro-3,3-dimethyl-2,4-dihydro-1H-quinoline (CID 141309286) is 2-[3-(4-tert-butylphenyl)phenyl]-6-chloro-3,3-dimethyl-2,4-dihydro-1H-quinoline.
What is the SMILES notation for 2-[3-(4-tert-butylphenyl)phenyl]-6-chloro-3,3-dimethyl-2,4-dihydro-1H-quinoline?
The canonical SMILES for 2-[3-(4-tert-butylphenyl)phenyl]-6-chloro-3,3-dimethyl-2,4-dihydro-1H-quinoline is CC(C)(C)c1ccc(-c2cccc(C3Nc4ccc(Cl)cc4CC3(C)C)c2)cc1.
What is the InChIKey of 2-[3-(4-tert-butylphenyl)phenyl]-6-chloro-3,3-dimethyl-2,4-dihydro-1H-quinoline?
The InChIKey is OVFQIRGVHSECQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H30ClN/c1-26(2,3)22-11-9-18(10-12-22)19-7-6-8-20(15-19)25-27(4,5)17-21-16-23(28)13-14-24(21)29-25/h6-16,25,29H,17H2,1-5H3.
What are the key properties of 2-[3-(4-tert-butylphenyl)phenyl]-6-chloro-3,3-dimethyl-2,4-dihydro-1H-quinoline?
2-[3-(4-tert-butylphenyl)phenyl]-6-chloro-3,3-dimethyl-2,4-dihydro-1H-quinoline has a molecular weight of 404.00 g/mol, XLogP of 8.04, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(4-tert-butylphenyl)phenyl]-6-chloro-3,3-dimethyl-2,4-dihydro-1H-quinoline is sourced from PubChem (CID 141309286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).