About 2-cyclohexyl-4-methyl-1,3-dioxole
2-cyclohexyl-4-methyl-1,3-dioxole (PubChem CID 141309438) has the molecular formula C10H16O2
and a molecular weight of 168.24 g/mol. Its IUPAC name is 2-cyclohexyl-4-methyl-1,3-dioxole.
Molecular Properties
| Compound Name | 2-cyclohexyl-4-methyl-1,3-dioxole |
| PubChem CID | 141309438 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 2-cyclohexyl-4-methyl-1,3-dioxole |
| SMILES | CC1=COC(C2CCCCC2)O1 |
| InChI | InChI=1S/C10H16O2/c1-8-7-11-10(12-8)9-5-3-2-4-6-9/h7,9-10H,2-6H2,1H3 |
| InChIKey | QPLJNQPBWARRAQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclohexyl-4-methyl-1,3-dioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-4-methyl-1,3-dioxole?
The IUPAC name of 2-cyclohexyl-4-methyl-1,3-dioxole (CID 141309438) is 2-cyclohexyl-4-methyl-1,3-dioxole.
What is the SMILES notation for 2-cyclohexyl-4-methyl-1,3-dioxole?
The canonical SMILES for 2-cyclohexyl-4-methyl-1,3-dioxole is CC1=COC(C2CCCCC2)O1.
What is the InChIKey of 2-cyclohexyl-4-methyl-1,3-dioxole?
The InChIKey is QPLJNQPBWARRAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O2/c1-8-7-11-10(12-8)9-5-3-2-4-6-9/h7,9-10H,2-6H2,1H3.
What are the key properties of 2-cyclohexyl-4-methyl-1,3-dioxole?
2-cyclohexyl-4-methyl-1,3-dioxole has a molecular weight of 168.24 g/mol, XLogP of 2.80, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-4-methyl-1,3-dioxole is sourced from PubChem (CID 141309438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).