About pyridazin-1-ium;2,4,6-trimethylbenzenesulfonate
pyridazin-1-ium;2,4,6-trimethylbenzenesulfonate (PubChem CID 141309451) has the molecular formula C13H16N2O3S
and a molecular weight of 280.35 g/mol. Its IUPAC name is pyridazin-1-ium;2,4,6-trimethylbenzenesulfonate.
Molecular Properties
| Compound Name | pyridazin-1-ium;2,4,6-trimethylbenzenesulfonate |
| PubChem CID | 141309451 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | pyridazin-1-ium;2,4,6-trimethylbenzenesulfonate |
| SMILES | Cc1cc(C)c(S(=O)(=O)[O-])c(C)c1.c1cc[nH+]nc1 |
| InChI | InChI=1S/C9H12O3S.C4H4N2/c1-6-4-7(2)9(8(3)5-6)13(10,11)12;1-2-4-6-5-3-1/h4-5H,1-3H3,(H,10,11,12);1-4H |
| InChIKey | MCECSWJJYDRJFX-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze pyridazin-1-ium;2,4,6-trimethylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridazin-1-ium;2,4,6-trimethylbenzenesulfonate?
The IUPAC name of pyridazin-1-ium;2,4,6-trimethylbenzenesulfonate (CID 141309451) is pyridazin-1-ium;2,4,6-trimethylbenzenesulfonate.
What is the SMILES notation for pyridazin-1-ium;2,4,6-trimethylbenzenesulfonate?
The canonical SMILES for pyridazin-1-ium;2,4,6-trimethylbenzenesulfonate is Cc1cc(C)c(S(=O)(=O)[O-])c(C)c1.c1cc[nH+]nc1.
What is the InChIKey of pyridazin-1-ium;2,4,6-trimethylbenzenesulfonate?
The InChIKey is MCECSWJJYDRJFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O3S.C4H4N2/c1-6-4-7(2)9(8(3)5-6)13(10,11)12;1-2-4-6-5-3-1/h4-5H,1-3H3,(H,10,11,12);1-4H.
What are the key properties of pyridazin-1-ium;2,4,6-trimethylbenzenesulfonate?
pyridazin-1-ium;2,4,6-trimethylbenzenesulfonate has a molecular weight of 280.35 g/mol, XLogP of 1.41, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyridazin-1-ium;2,4,6-trimethylbenzenesulfonate is sourced from PubChem (CID 141309451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).