C14H10O4 — CID 141309554
2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,8(16),11-tetraene-3,10-dione (PubChem CID 141309554) has the molecular formula C14H10O4 and a molecular weight of 242.23 g/mol. Its IUPAC name is 2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,8(16),11-tetraene-3,10-dione.
| Compound Name | 2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,8(16),11-tetraene-3,10-dione |
|---|---|
| PubChem CID | 141309554 |
| Molecular Formula | C14H10O4 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,8(16),11-tetraene-3,10-dione |
| SMILES | O=c1oc2c3c(c(=O)oc4c3c1=CCC4)=CCC2 |
| InChI | InChI=1S/C14H10O4/c15-13-7-3-1-5-9-11(7)12-8(14(16)17-9)4-2-6-10(12)18-13/h3-4H,1-2,5-6H2 |
| InChIKey | IKJQIIBVSWMJPQ-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |