About (E)-6-[(E)-prop-1-enyl]non-7-ene-1,6-diol
(E)-6-[(E)-prop-1-enyl]non-7-ene-1,6-diol (PubChem CID 141309557) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is (E)-6-[(E)-prop-1-enyl]non-7-ene-1,6-diol.
Molecular Properties
| Compound Name | (E)-6-[(E)-prop-1-enyl]non-7-ene-1,6-diol |
| PubChem CID | 141309557 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (E)-6-[(E)-prop-1-enyl]non-7-ene-1,6-diol |
| SMILES | C/C=C/C(O)(/C=C/C)CCCCCO |
| InChI | InChI=1S/C12H22O2/c1-3-8-12(14,9-4-2)10-6-5-7-11-13/h3-4,8-9,13-14H,5-7,10-11H2,1-2H3/b8-3+,9-4+ |
| InChIKey | GJYDJFVRLUSTJG-BQYBEJQRSA-N |
| XLogP | 2.42 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-6-[(E)-prop-1-enyl]non-7-ene-1,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-6-[(E)-prop-1-enyl]non-7-ene-1,6-diol?
The IUPAC name of (E)-6-[(E)-prop-1-enyl]non-7-ene-1,6-diol (CID 141309557) is (E)-6-[(E)-prop-1-enyl]non-7-ene-1,6-diol.
What is the SMILES notation for (E)-6-[(E)-prop-1-enyl]non-7-ene-1,6-diol?
The canonical SMILES for (E)-6-[(E)-prop-1-enyl]non-7-ene-1,6-diol is C/C=C/C(O)(/C=C/C)CCCCCO.
What is the InChIKey of (E)-6-[(E)-prop-1-enyl]non-7-ene-1,6-diol?
The InChIKey is GJYDJFVRLUSTJG-BQYBEJQRSA-N. The full InChI is InChI=1S/C12H22O2/c1-3-8-12(14,9-4-2)10-6-5-7-11-13/h3-4,8-9,13-14H,5-7,10-11H2,1-2H3/b8-3+,9-4+.
What are the key properties of (E)-6-[(E)-prop-1-enyl]non-7-ene-1,6-diol?
(E)-6-[(E)-prop-1-enyl]non-7-ene-1,6-diol has a molecular weight of 198.31 g/mol, XLogP of 2.42, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-6-[(E)-prop-1-enyl]non-7-ene-1,6-diol is sourced from PubChem (CID 141309557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).