C13H20O4 — CID 141309584
1,1,1,3-tetrakis(ethenoxy)-2,2-dimethylpropane (PubChem CID 141309584) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is 1,1,1,3-tetrakis(ethenoxy)-2,2-dimethylpropane.
| Compound Name | 1,1,1,3-tetrakis(ethenoxy)-2,2-dimethylpropane |
|---|---|
| PubChem CID | 141309584 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 1,1,1,3-tetrakis(ethenoxy)-2,2-dimethylpropane |
| SMILES | C=COCC(C)(C)C(OC=C)(OC=C)OC=C |
| InChI | InChI=1S/C13H20O4/c1-7-14-11-12(5,6)13(15-8-2,16-9-3)17-10-4/h7-10H,1-4,11H2,5-6H3 |
| InChIKey | RCDBJHGIVYLSNQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|