C21H24FN3O5 — CID 141309836
5-[5-(3,5-dimethoxyphenyl)-3-methylimidazol-4-yl]-N-fluoro-2,3,4-trimethoxyaniline (PubChem CID 141309836) has the molecular formula C21H24FN3O5 and a molecular weight of 417.44 g/mol. Its IUPAC name is 5-[5-(3,5-dimethoxyphenyl)-3-methylimidazol-4-yl]-N-fluoro-2,3,4-trimethoxyaniline.
| Compound Name | 5-[5-(3,5-dimethoxyphenyl)-3-methylimidazol-4-yl]-N-fluoro-2,3,4-trimethoxyaniline |
|---|---|
| PubChem CID | 141309836 |
| Molecular Formula | C21H24FN3O5 |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 5-[5-(3,5-dimethoxyphenyl)-3-methylimidazol-4-yl]-N-fluoro-2,3,4-trimethoxyaniline |
| SMILES | COc1cc(OC)cc(-c2ncn(C)c2-c2cc(NF)c(OC)c(OC)c2OC)c1 |
| InChI | InChI=1S/C21H24FN3O5/c1-25-11-23-17(12-7-13(26-2)9-14(8-12)27-3)18(25)15-10-16(24-22)20(29-5)21(30-6)19(15)28-4/h7-11,24H,1-6H3 |
| InChIKey | VBEBLXRWBZMRJK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 76.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|