C16H16N4O2S — CID 141310639
5-(4-pyrimidin-2-yloxyphenyl)-6-sulfanyl-5,7-diazaspiro[3.4]octan-8-one (PubChem CID 141310639) has the molecular formula C16H16N4O2S and a molecular weight of 328.40 g/mol. Its IUPAC name is 5-(4-pyrimidin-2-yloxyphenyl)-6-sulfanyl-5,7-diazaspiro[3.4]octan-8-one.
| Compound Name | 5-(4-pyrimidin-2-yloxyphenyl)-6-sulfanyl-5,7-diazaspiro[3.4]octan-8-one |
|---|---|
| PubChem CID | 141310639 |
| Molecular Formula | C16H16N4O2S |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 5-(4-pyrimidin-2-yloxyphenyl)-6-sulfanyl-5,7-diazaspiro[3.4]octan-8-one |
| SMILES | O=C1NC(S)N(c2ccc(Oc3ncccn3)cc2)C12CCC2 |
| InChI | InChI=1S/C16H16N4O2S/c21-13-16(7-1-8-16)20(15(23)19-13)11-3-5-12(6-4-11)22-14-17-9-2-10-18-14/h2-6,9-10,15,23H,1,7-8H2,(H,19,21) |
| InChIKey | BTIDKOPURMOQFF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|