C9H18N2O3S — CID 141310656
(2S)-2,6-diamino-3-methyl-2-(2-sulfanylacetyl)hexanoic acid (PubChem CID 141310656) has the molecular formula C9H18N2O3S and a molecular weight of 234.32 g/mol. Its IUPAC name is (2S)-2,6-diamino-3-methyl-2-(2-sulfanylacetyl)hexanoic acid.
| Compound Name | (2S)-2,6-diamino-3-methyl-2-(2-sulfanylacetyl)hexanoic acid |
|---|---|
| PubChem CID | 141310656 |
| Molecular Formula | C9H18N2O3S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | (2S)-2,6-diamino-3-methyl-2-(2-sulfanylacetyl)hexanoic acid |
| SMILES | CC(CCCN)[C@@](N)(C(=O)O)C(=O)CS |
| InChI | InChI=1S/C9H18N2O3S/c1-6(3-2-4-10)9(11,8(13)14)7(12)5-15/h6,15H,2-5,10-11H2,1H3,(H,13,14)/t6?,9-/m0/s1 |
| InChIKey | NLQMFLSMWHCNEB-HSOSERFQSA-N |
| XLogP | -0.36 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|