About 3H-[1,2]oxazolo[4,3-d]triazin-4-one
3H-[1,2]oxazolo[4,3-d]triazin-4-one (PubChem CID 141311007) has the molecular formula C4H2N4O2
and a molecular weight of 138.09 g/mol. Its IUPAC name is 3H-[1,2]oxazolo[4,3-d]triazin-4-one.
Molecular Properties
| Compound Name | 3H-[1,2]oxazolo[4,3-d]triazin-4-one |
| PubChem CID | 141311007 |
| Molecular Formula | C4H2N4O2 |
| Molecular Weight | 138.09 g/mol |
| Exact Mass | 138.02 |
| IUPAC Name | 3H-[1,2]oxazolo[4,3-d]triazin-4-one |
| SMILES | O=c1[nH]nnc2conc12 |
| InChI | InChI=1S/C4H2N4O2/c9-4-3-2(1-10-7-3)5-8-6-4/h1H,(H,5,6,9) |
| InChIKey | KMTHASOYWLTORG-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.09 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3H-[1,2]oxazolo[4,3-d]triazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-[1,2]oxazolo[4,3-d]triazin-4-one?
The IUPAC name of 3H-[1,2]oxazolo[4,3-d]triazin-4-one (CID 141311007) is 3H-[1,2]oxazolo[4,3-d]triazin-4-one.
What is the SMILES notation for 3H-[1,2]oxazolo[4,3-d]triazin-4-one?
The canonical SMILES for 3H-[1,2]oxazolo[4,3-d]triazin-4-one is O=c1[nH]nnc2conc12.
What is the InChIKey of 3H-[1,2]oxazolo[4,3-d]triazin-4-one?
The InChIKey is KMTHASOYWLTORG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2N4O2/c9-4-3-2(1-10-7-3)5-8-6-4/h1H,(H,5,6,9).
What are the key properties of 3H-[1,2]oxazolo[4,3-d]triazin-4-one?
3H-[1,2]oxazolo[4,3-d]triazin-4-one has a molecular weight of 138.09 g/mol, XLogP of -0.69, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-[1,2]oxazolo[4,3-d]triazin-4-one is sourced from PubChem (CID 141311007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).