C16H19N5S — CID 141311939
4-(2,3-dihydro-1H-1,2,4-triazol-5-yl)-2-(4-piperidin-1-ylphenyl)-1,3-thiazole (PubChem CID 141311939) has the molecular formula C16H19N5S and a molecular weight of 313.43 g/mol. Its IUPAC name is 4-(2,3-dihydro-1H-1,2,4-triazol-5-yl)-2-(4-piperidin-1-ylphenyl)-1,3-thiazole.
| Compound Name | 4-(2,3-dihydro-1H-1,2,4-triazol-5-yl)-2-(4-piperidin-1-ylphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 141311939 |
| Molecular Formula | C16H19N5S |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 4-(2,3-dihydro-1H-1,2,4-triazol-5-yl)-2-(4-piperidin-1-ylphenyl)-1,3-thiazole |
| SMILES | c1cc(N2CCCCC2)ccc1-c1nc(C2=NCNN2)cs1 |
| InChI | InChI=1S/C16H19N5S/c1-2-8-21(9-3-1)13-6-4-12(5-7-13)16-19-14(10-22-16)15-17-11-18-20-15/h4-7,10,18H,1-3,8-9,11H2,(H,17,20) |
| InChIKey | CHIBHOXCMGHUJO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|