About [tris(dimethylcarbamothioylsulfanyl)-λ4-tellanyl] N,N-dimethylcarbamodithioate
[tris(dimethylcarbamothioylsulfanyl)-λ4-tellanyl] N,N-dimethylcarbamodithioate (PubChem CID 141312175) has the molecular formula C12H24N4S8Te
and a molecular weight of 608.49 g/mol. Its IUPAC name is [tris(dimethylcarbamothioylsulfanyl)-λ4-tellanyl] N,N-dimethylcarbamodithioate.
Molecular Properties
| Compound Name | [tris(dimethylcarbamothioylsulfanyl)-λ4-tellanyl] N,N-dimethylcarbamodithioate |
| PubChem CID | 141312175 |
| Molecular Formula | C12H24N4S8Te |
| Molecular Weight | 608.49 g/mol |
| Exact Mass | 609.88 |
| IUPAC Name | [tris(dimethylcarbamothioylsulfanyl)-λ4-tellanyl] N,N-dimethylcarbamodithioate |
| SMILES | CN(C)C(=S)S[Te](SC(=S)N(C)C)(SC(=S)N(C)C)SC(=S)N(C)C |
| InChI | InChI=1S/C12H24N4S8Te/c1-13(2)9(17)21-25(22-10(18)14(3)4,23-11(19)15(5)6)24-12(20)16(7)8/h1-8H3 |
| InChIKey | JQAPSMRAHFUICL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 608.49 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [tris(dimethylcarbamothioylsulfanyl)-λ4-tellanyl] N,N-dimethylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [tris(dimethylcarbamothioylsulfanyl)-λ4-tellanyl] N,N-dimethylcarbamodithioate?
The IUPAC name of [tris(dimethylcarbamothioylsulfanyl)-λ4-tellanyl] N,N-dimethylcarbamodithioate (CID 141312175) is [tris(dimethylcarbamothioylsulfanyl)-λ4-tellanyl] N,N-dimethylcarbamodithioate.
What is the SMILES notation for [tris(dimethylcarbamothioylsulfanyl)-λ4-tellanyl] N,N-dimethylcarbamodithioate?
The canonical SMILES for [tris(dimethylcarbamothioylsulfanyl)-λ4-tellanyl] N,N-dimethylcarbamodithioate is CN(C)C(=S)S[Te](SC(=S)N(C)C)(SC(=S)N(C)C)SC(=S)N(C)C.
What is the InChIKey of [tris(dimethylcarbamothioylsulfanyl)-λ4-tellanyl] N,N-dimethylcarbamodithioate?
The InChIKey is JQAPSMRAHFUICL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N4S8Te/c1-13(2)9(17)21-25(22-10(18)14(3)4,23-11(19)15(5)6)24-12(20)16(7)8/h1-8H3.
What are the key properties of [tris(dimethylcarbamothioylsulfanyl)-λ4-tellanyl] N,N-dimethylcarbamodithioate?
[tris(dimethylcarbamothioylsulfanyl)-λ4-tellanyl] N,N-dimethylcarbamodithioate has a molecular weight of 608.49 g/mol, XLogP of 3.74, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [tris(dimethylcarbamothioylsulfanyl)-λ4-tellanyl] N,N-dimethylcarbamodithioate is sourced from PubChem (CID 141312175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).