About pyrrolo[2,1-b][1,3]thiazole;hydrochloride
pyrrolo[2,1-b][1,3]thiazole;hydrochloride (PubChem CID 141312251) has the molecular formula C6H6ClNS
and a molecular weight of 159.64 g/mol. Its IUPAC name is pyrrolo[2,1-b][1,3]thiazole;hydrochloride.
Molecular Properties
| Compound Name | pyrrolo[2,1-b][1,3]thiazole;hydrochloride |
| PubChem CID | 141312251 |
| Molecular Formula | C6H6ClNS |
| Molecular Weight | 159.64 g/mol |
| Exact Mass | 158.99 |
| IUPAC Name | pyrrolo[2,1-b][1,3]thiazole;hydrochloride |
| SMILES | Cl.c1cc2sccn2c1 |
| InChI | InChI=1S/C6H5NS.ClH/c1-2-6-7(3-1)4-5-8-6;/h1-5H;1H |
| InChIKey | SPNPCLBKYLBCQH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 4.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.64 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze pyrrolo[2,1-b][1,3]thiazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolo[2,1-b][1,3]thiazole;hydrochloride?
The IUPAC name of pyrrolo[2,1-b][1,3]thiazole;hydrochloride (CID 141312251) is pyrrolo[2,1-b][1,3]thiazole;hydrochloride.
What is the SMILES notation for pyrrolo[2,1-b][1,3]thiazole;hydrochloride?
The canonical SMILES for pyrrolo[2,1-b][1,3]thiazole;hydrochloride is Cl.c1cc2sccn2c1.
What is the InChIKey of pyrrolo[2,1-b][1,3]thiazole;hydrochloride?
The InChIKey is SPNPCLBKYLBCQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NS.ClH/c1-2-6-7(3-1)4-5-8-6;/h1-5H;1H.
What are the key properties of pyrrolo[2,1-b][1,3]thiazole;hydrochloride?
pyrrolo[2,1-b][1,3]thiazole;hydrochloride has a molecular weight of 159.64 g/mol, XLogP of 2.42, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolo[2,1-b][1,3]thiazole;hydrochloride is sourced from PubChem (CID 141312251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).