C22H19N — CID 141313098
4-methyl-N-phenyl-N-(4-prop-2-ynylphenyl)aniline (PubChem CID 141313098) has the molecular formula C22H19N and a molecular weight of 297.40 g/mol. Its IUPAC name is 4-methyl-N-phenyl-N-(4-prop-2-ynylphenyl)aniline.
| Compound Name | 4-methyl-N-phenyl-N-(4-prop-2-ynylphenyl)aniline |
|---|---|
| PubChem CID | 141313098 |
| Molecular Formula | C22H19N |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 4-methyl-N-phenyl-N-(4-prop-2-ynylphenyl)aniline |
| SMILES | C#CCc1ccc(N(c2ccccc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C22H19N/c1-3-7-19-12-16-22(17-13-19)23(20-8-5-4-6-9-20)21-14-10-18(2)11-15-21/h1,4-6,8-17H,7H2,2H3 |
| InChIKey | YCNDXSGHTYJDSL-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|