About 5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole
5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole (PubChem CID 141313211) has the molecular formula C10H5Cl2F4NO
and a molecular weight of 302.05 g/mol. Its IUPAC name is 5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole.
Molecular Properties
| Compound Name | 5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole |
| PubChem CID | 141313211 |
| Molecular Formula | C10H5Cl2F4NO |
| Molecular Weight | 302.05 g/mol |
| Exact Mass | 300.97 |
| IUPAC Name | 5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole |
| SMILES | Fc1c(Cl)cc(C2(C(F)(F)F)CC=NO2)cc1Cl |
| InChI | InChI=1S/C10H5Cl2F4NO/c11-6-3-5(4-7(12)8(6)13)9(10(14,15)16)1-2-17-18-9/h2-4H,1H2 |
| InChIKey | MSZGXAGUDQTXTJ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.05 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole?
The IUPAC name of 5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole (CID 141313211) is 5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole.
What is the SMILES notation for 5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole?
The canonical SMILES for 5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole is Fc1c(Cl)cc(C2(C(F)(F)F)CC=NO2)cc1Cl.
What is the InChIKey of 5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole?
The InChIKey is MSZGXAGUDQTXTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5Cl2F4NO/c11-6-3-5(4-7(12)8(6)13)9(10(14,15)16)1-2-17-18-9/h2-4H,1H2.
What are the key properties of 5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole?
5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole has a molecular weight of 302.05 g/mol, XLogP of 4.30, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole is sourced from PubChem (CID 141313211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).