About 5-butylnonan-5-yl(pyrazolo[1,5-a]pyrazin-3-yl)tin
5-butylnonan-5-yl(pyrazolo[1,5-a]pyrazin-3-yl)tin (PubChem CID 141313271) has the molecular formula C19H31N3Sn
and a molecular weight of 420.19 g/mol. Its IUPAC name is 5-butylnonan-5-yl(pyrazolo[1,5-a]pyrazin-3-yl)tin.
Molecular Properties
| Compound Name | 5-butylnonan-5-yl(pyrazolo[1,5-a]pyrazin-3-yl)tin |
| PubChem CID | 141313271 |
| Molecular Formula | C19H31N3Sn |
| Molecular Weight | 420.19 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 5-butylnonan-5-yl(pyrazolo[1,5-a]pyrazin-3-yl)tin |
| SMILES | CCCCC(CCCC)(CCCC)[Sn]c1cnn2ccncc12 |
| InChI | InChI=1S/C13H27.C6H4N3.Sn/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-2-8-9-4-3-7-5-6(1)9;/h4-12H2,1-3H3;2-5H; |
| InChIKey | SZKSAVPTZXONFA-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.19 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-butylnonan-5-yl(pyrazolo[1,5-a]pyrazin-3-yl)tin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butylnonan-5-yl(pyrazolo[1,5-a]pyrazin-3-yl)tin?
The IUPAC name of 5-butylnonan-5-yl(pyrazolo[1,5-a]pyrazin-3-yl)tin (CID 141313271) is 5-butylnonan-5-yl(pyrazolo[1,5-a]pyrazin-3-yl)tin.
What is the SMILES notation for 5-butylnonan-5-yl(pyrazolo[1,5-a]pyrazin-3-yl)tin?
The canonical SMILES for 5-butylnonan-5-yl(pyrazolo[1,5-a]pyrazin-3-yl)tin is CCCCC(CCCC)(CCCC)[Sn]c1cnn2ccncc12.
What is the InChIKey of 5-butylnonan-5-yl(pyrazolo[1,5-a]pyrazin-3-yl)tin?
The InChIKey is SZKSAVPTZXONFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27.C6H4N3.Sn/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-2-8-9-4-3-7-5-6(1)9;/h4-12H2,1-3H3;2-5H;.
What are the key properties of 5-butylnonan-5-yl(pyrazolo[1,5-a]pyrazin-3-yl)tin?
5-butylnonan-5-yl(pyrazolo[1,5-a]pyrazin-3-yl)tin has a molecular weight of 420.19 g/mol, XLogP of 4.79, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butylnonan-5-yl(pyrazolo[1,5-a]pyrazin-3-yl)tin is sourced from PubChem (CID 141313271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).