About 2-pyrazolo[1,5-a]pyrazin-3-yl-7,9-dihydropurin-8-one
2-pyrazolo[1,5-a]pyrazin-3-yl-7,9-dihydropurin-8-one (PubChem CID 141313280) has the molecular formula C11H7N7O
and a molecular weight of 253.23 g/mol. Its IUPAC name is 2-pyrazolo[1,5-a]pyrazin-3-yl-7,9-dihydropurin-8-one.
Molecular Properties
| Compound Name | 2-pyrazolo[1,5-a]pyrazin-3-yl-7,9-dihydropurin-8-one |
| PubChem CID | 141313280 |
| Molecular Formula | C11H7N7O |
| Molecular Weight | 253.23 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 2-pyrazolo[1,5-a]pyrazin-3-yl-7,9-dihydropurin-8-one |
| SMILES | O=c1[nH]c2cnc(-c3cnn4ccncc34)nc2[nH]1 |
| InChI | InChI=1S/C11H7N7O/c19-11-15-7-4-13-9(16-10(7)17-11)6-3-14-18-2-1-12-5-8(6)18/h1-5H,(H2,13,15,16,17,19) |
| InChIKey | RXYMITKBXWBKKJ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 104.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.23 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-pyrazolo[1,5-a]pyrazin-3-yl-7,9-dihydropurin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrazolo[1,5-a]pyrazin-3-yl-7,9-dihydropurin-8-one?
The IUPAC name of 2-pyrazolo[1,5-a]pyrazin-3-yl-7,9-dihydropurin-8-one (CID 141313280) is 2-pyrazolo[1,5-a]pyrazin-3-yl-7,9-dihydropurin-8-one.
What is the SMILES notation for 2-pyrazolo[1,5-a]pyrazin-3-yl-7,9-dihydropurin-8-one?
The canonical SMILES for 2-pyrazolo[1,5-a]pyrazin-3-yl-7,9-dihydropurin-8-one is O=c1[nH]c2cnc(-c3cnn4ccncc34)nc2[nH]1.
What is the InChIKey of 2-pyrazolo[1,5-a]pyrazin-3-yl-7,9-dihydropurin-8-one?
The InChIKey is RXYMITKBXWBKKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N7O/c19-11-15-7-4-13-9(16-10(7)17-11)6-3-14-18-2-1-12-5-8(6)18/h1-5H,(H2,13,15,16,17,19).
What are the key properties of 2-pyrazolo[1,5-a]pyrazin-3-yl-7,9-dihydropurin-8-one?
2-pyrazolo[1,5-a]pyrazin-3-yl-7,9-dihydropurin-8-one has a molecular weight of 253.23 g/mol, XLogP of 0.36, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrazolo[1,5-a]pyrazin-3-yl-7,9-dihydropurin-8-one is sourced from PubChem (CID 141313280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).