About 9-(1,1-dioxothiolan-3-yl)-7H-purin-8-one
9-(1,1-dioxothiolan-3-yl)-7H-purin-8-one (PubChem CID 141313281) has the molecular formula C9H10N4O3S
and a molecular weight of 254.27 g/mol. Its IUPAC name is 9-(1,1-dioxothiolan-3-yl)-7H-purin-8-one.
Molecular Properties
| Compound Name | 9-(1,1-dioxothiolan-3-yl)-7H-purin-8-one |
| PubChem CID | 141313281 |
| Molecular Formula | C9H10N4O3S |
| Molecular Weight | 254.27 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 9-(1,1-dioxothiolan-3-yl)-7H-purin-8-one |
| SMILES | O=c1[nH]c2cncnc2n1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H10N4O3S/c14-9-12-7-3-10-5-11-8(7)13(9)6-1-2-17(15,16)4-6/h3,5-6H,1-2,4H2,(H,12,14) |
| InChIKey | ISRGRRXJJMQSCP-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.27 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 9-(1,1-dioxothiolan-3-yl)-7H-purin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(1,1-dioxothiolan-3-yl)-7H-purin-8-one?
The IUPAC name of 9-(1,1-dioxothiolan-3-yl)-7H-purin-8-one (CID 141313281) is 9-(1,1-dioxothiolan-3-yl)-7H-purin-8-one.
What is the SMILES notation for 9-(1,1-dioxothiolan-3-yl)-7H-purin-8-one?
The canonical SMILES for 9-(1,1-dioxothiolan-3-yl)-7H-purin-8-one is O=c1[nH]c2cncnc2n1C1CCS(=O)(=O)C1.
What is the InChIKey of 9-(1,1-dioxothiolan-3-yl)-7H-purin-8-one?
The InChIKey is ISRGRRXJJMQSCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O3S/c14-9-12-7-3-10-5-11-8(7)13(9)6-1-2-17(15,16)4-6/h3,5-6H,1-2,4H2,(H,12,14).
What are the key properties of 9-(1,1-dioxothiolan-3-yl)-7H-purin-8-one?
9-(1,1-dioxothiolan-3-yl)-7H-purin-8-one has a molecular weight of 254.27 g/mol, XLogP of -0.52, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(1,1-dioxothiolan-3-yl)-7H-purin-8-one is sourced from PubChem (CID 141313281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).