About 3-(furan-2-yl)-2-(1H-imidazol-2-yl)-4-(1,2-oxazol-3-yl)-5-(1,2-thiazol-3-yl)oxadiazole
3-(furan-2-yl)-2-(1H-imidazol-2-yl)-4-(1,2-oxazol-3-yl)-5-(1,2-thiazol-3-yl)oxadiazole (PubChem CID 141314194) has the molecular formula C15H10N6O3S
and a molecular weight of 354.35 g/mol. Its IUPAC name is 3-(furan-2-yl)-2-(1H-imidazol-2-yl)-4-(1,2-oxazol-3-yl)-5-(1,2-thiazol-3-yl)oxadiazole.
Molecular Properties
| Compound Name | 3-(furan-2-yl)-2-(1H-imidazol-2-yl)-4-(1,2-oxazol-3-yl)-5-(1,2-thiazol-3-yl)oxadiazole |
| PubChem CID | 141314194 |
| Molecular Formula | C15H10N6O3S |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | 3-(furan-2-yl)-2-(1H-imidazol-2-yl)-4-(1,2-oxazol-3-yl)-5-(1,2-thiazol-3-yl)oxadiazole |
| SMILES | c1coc(N2C(c3ccon3)=C(c3ccsn3)ON2c2ncc[nH]2)c1 |
| InChI | InChI=1S/C15H10N6O3S/c1-2-12(22-7-1)20-13(10-3-8-23-18-10)14(11-4-9-25-19-11)24-21(20)15-16-5-6-17-15/h1-9H,(H,16,17) |
| InChIKey | XMFZTXZMMCKGFY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 3-(furan-2-yl)-2-(1H-imidazol-2-yl)-4-(1,2-oxazol-3-yl)-5-(1,2-thiazol-3-yl)oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(furan-2-yl)-2-(1H-imidazol-2-yl)-4-(1,2-oxazol-3-yl)-5-(1,2-thiazol-3-yl)oxadiazole?
The IUPAC name of 3-(furan-2-yl)-2-(1H-imidazol-2-yl)-4-(1,2-oxazol-3-yl)-5-(1,2-thiazol-3-yl)oxadiazole (CID 141314194) is 3-(furan-2-yl)-2-(1H-imidazol-2-yl)-4-(1,2-oxazol-3-yl)-5-(1,2-thiazol-3-yl)oxadiazole.
What is the SMILES notation for 3-(furan-2-yl)-2-(1H-imidazol-2-yl)-4-(1,2-oxazol-3-yl)-5-(1,2-thiazol-3-yl)oxadiazole?
The canonical SMILES for 3-(furan-2-yl)-2-(1H-imidazol-2-yl)-4-(1,2-oxazol-3-yl)-5-(1,2-thiazol-3-yl)oxadiazole is c1coc(N2C(c3ccon3)=C(c3ccsn3)ON2c2ncc[nH]2)c1.
What is the InChIKey of 3-(furan-2-yl)-2-(1H-imidazol-2-yl)-4-(1,2-oxazol-3-yl)-5-(1,2-thiazol-3-yl)oxadiazole?
The InChIKey is XMFZTXZMMCKGFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N6O3S/c1-2-12(22-7-1)20-13(10-3-8-23-18-10)14(11-4-9-25-19-11)24-21(20)15-16-5-6-17-15/h1-9H,(H,16,17).
What are the key properties of 3-(furan-2-yl)-2-(1H-imidazol-2-yl)-4-(1,2-oxazol-3-yl)-5-(1,2-thiazol-3-yl)oxadiazole?
3-(furan-2-yl)-2-(1H-imidazol-2-yl)-4-(1,2-oxazol-3-yl)-5-(1,2-thiazol-3-yl)oxadiazole has a molecular weight of 354.35 g/mol, XLogP of 3.15, 4 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(furan-2-yl)-2-(1H-imidazol-2-yl)-4-(1,2-oxazol-3-yl)-5-(1,2-thiazol-3-yl)oxadiazole is sourced from PubChem (CID 141314194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).