C18H19FN4 — CID 141314287
2-(4,4-dimethyl-1,3-diazinan-1-yl)-5-[2-(3-fluorophenyl)ethynyl]pyrazine (PubChem CID 141314287) has the molecular formula C18H19FN4 and a molecular weight of 310.38 g/mol. Its IUPAC name is 2-(4,4-dimethyl-1,3-diazinan-1-yl)-5-[2-(3-fluorophenyl)ethynyl]pyrazine.
| Compound Name | 2-(4,4-dimethyl-1,3-diazinan-1-yl)-5-[2-(3-fluorophenyl)ethynyl]pyrazine |
|---|---|
| PubChem CID | 141314287 |
| Molecular Formula | C18H19FN4 |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 2-(4,4-dimethyl-1,3-diazinan-1-yl)-5-[2-(3-fluorophenyl)ethynyl]pyrazine |
| SMILES | CC1(C)CCN(c2cnc(C#Cc3cccc(F)c3)cn2)CN1 |
| InChI | InChI=1S/C18H19FN4/c1-18(2)8-9-23(13-22-18)17-12-20-16(11-21-17)7-6-14-4-3-5-15(19)10-14/h3-5,10-12,22H,8-9,13H2,1-2H3 |
| InChIKey | UXMJYPKHVIDTTQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|