About N-[3-fluoro-4-(4-methylsulfonylpiperazin-1-yl)phenyl]thieno[3,2-d]pyrimidin-2-amine
N-[3-fluoro-4-(4-methylsulfonylpiperazin-1-yl)phenyl]thieno[3,2-d]pyrimidin-2-amine (PubChem CID 141314550) has the molecular formula C17H18FN5O2S2
and a molecular weight of 407.50 g/mol. Its IUPAC name is N-[3-fluoro-4-(4-methylsulfonylpiperazin-1-yl)phenyl]thieno[3,2-d]pyrimidin-2-amine.
Molecular Properties
| Compound Name | N-[3-fluoro-4-(4-methylsulfonylpiperazin-1-yl)phenyl]thieno[3,2-d]pyrimidin-2-amine |
| PubChem CID | 141314550 |
| Molecular Formula | C17H18FN5O2S2 |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | N-[3-fluoro-4-(4-methylsulfonylpiperazin-1-yl)phenyl]thieno[3,2-d]pyrimidin-2-amine |
| SMILES | CS(=O)(=O)N1CCN(c2ccc(Nc3ncc4sccc4n3)cc2F)CC1 |
| InChI | InChI=1S/C17H18FN5O2S2/c1-27(24,25)23-7-5-22(6-8-23)15-3-2-12(10-13(15)18)20-17-19-11-16-14(21-17)4-9-26-16/h2-4,9-11H,5-8H2,1H3,(H,19,20,21) |
| InChIKey | WQEPLZOZDKTCQU-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze N-[3-fluoro-4-(4-methylsulfonylpiperazin-1-yl)phenyl]thieno[3,2-d]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-fluoro-4-(4-methylsulfonylpiperazin-1-yl)phenyl]thieno[3,2-d]pyrimidin-2-amine?
The IUPAC name of N-[3-fluoro-4-(4-methylsulfonylpiperazin-1-yl)phenyl]thieno[3,2-d]pyrimidin-2-amine (CID 141314550) is N-[3-fluoro-4-(4-methylsulfonylpiperazin-1-yl)phenyl]thieno[3,2-d]pyrimidin-2-amine.
What is the SMILES notation for N-[3-fluoro-4-(4-methylsulfonylpiperazin-1-yl)phenyl]thieno[3,2-d]pyrimidin-2-amine?
The canonical SMILES for N-[3-fluoro-4-(4-methylsulfonylpiperazin-1-yl)phenyl]thieno[3,2-d]pyrimidin-2-amine is CS(=O)(=O)N1CCN(c2ccc(Nc3ncc4sccc4n3)cc2F)CC1.
What is the InChIKey of N-[3-fluoro-4-(4-methylsulfonylpiperazin-1-yl)phenyl]thieno[3,2-d]pyrimidin-2-amine?
The InChIKey is WQEPLZOZDKTCQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18FN5O2S2/c1-27(24,25)23-7-5-22(6-8-23)15-3-2-12(10-13(15)18)20-17-19-11-16-14(21-17)4-9-26-16/h2-4,9-11H,5-8H2,1H3,(H,19,20,21).
What are the key properties of N-[3-fluoro-4-(4-methylsulfonylpiperazin-1-yl)phenyl]thieno[3,2-d]pyrimidin-2-amine?
N-[3-fluoro-4-(4-methylsulfonylpiperazin-1-yl)phenyl]thieno[3,2-d]pyrimidin-2-amine has a molecular weight of 407.50 g/mol, XLogP of 2.66, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-fluoro-4-(4-methylsulfonylpiperazin-1-yl)phenyl]thieno[3,2-d]pyrimidin-2-amine is sourced from PubChem (CID 141314550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).