C16H31BrO — CID 141315098
4-(8-bromooctoxy)-1,1-dimethylcyclohexane (PubChem CID 141315098) has the molecular formula C16H31BrO and a molecular weight of 319.33 g/mol. Its IUPAC name is 4-(8-bromooctoxy)-1,1-dimethylcyclohexane.
| Compound Name | 4-(8-bromooctoxy)-1,1-dimethylcyclohexane |
|---|---|
| PubChem CID | 141315098 |
| Molecular Formula | C16H31BrO |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 4-(8-bromooctoxy)-1,1-dimethylcyclohexane |
| SMILES | CC1(C)CCC(OCCCCCCCCBr)CC1 |
| InChI | InChI=1S/C16H31BrO/c1-16(2)11-9-15(10-12-16)18-14-8-6-4-3-5-7-13-17/h15H,3-14H2,1-2H3 |
| InChIKey | RJTOYJVXGPUBDU-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|